* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-METHYL-5,6-DIHYDROIMIDAZO[2,1-B][1,3]THIAZOLE |
CAS: | 55114-48-2 |
English Synonyms: | 3-METHYL-5,6-DIHYDROIMIDAZO[2,1-B][1,3]THIAZOLE ; 3-METHYL-5H,6H-IMIDAZO[2,1-B][1,3]THIAZOLE |
MDL Number.: | MFCD00231574 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1=CSC2=NCCN12 |
InChi: | InChI=1S/C6H8N2S/c1-5-4-9-6-7-2-3-8(5)6/h4H,2-3H2,1H3 |
InChiKey: | InChIKey=GOXKEFJIGQQOOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.