* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-BROMO-5-ETHYLNONANE |
CAS: | 55162-38-4 |
English Synonyms: | 2-BROMO-5-ETHYLNONANE |
MDL Number.: | MFCD18357421 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCC(CC)CCC(C)Br |
InChi: | InChI=1S/C11H23Br/c1-4-6-7-11(5-2)9-8-10(3)12/h10-11H,4-9H2,1-3H3 |
InChiKey: | InChIKey=BDRKPKUQFZFXIL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.