* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | AUSTOCYSTINB |
CAS: | 55256-57-0 |
English Synonyms: | AUSTOCYSTINB |
MDL Number.: | MFCD00133116 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC(C)(CCc1ccc(c2c1oc3cc4c(c(c3c2=O)O)[C@@H]5C=CO[C@@H]5O4)O)O |
InChi: | InChI=1S/C22H20O7/c1-22(2,26)7-5-10-3-4-12(23)16-19(25)17-14(28-20(10)16)9-13-15(18(17)24)11-6-8-27-21(11)29-13/h3-4,6,8-9,11,21,23-24,26H,5,7H2,1-2H3/t11-,21+/m0/s1 |
InChiKey: | InChIKey=JWPAJVNQGTWPMI-WIUDPPPLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.