* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-AMINO-9-BENZYL-6-IODOPURINE |
CAS: | 553645-21-9 |
English Synonyms: | 2-AMINO-9-BENZYL-6-IODOPURINE |
MDL Number.: | MFCD09266164 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Cn2cnc3c2nc(nc3I)N |
InChi: | InChI=1S/C12H10IN5/c13-10-9-11(17-12(14)16-10)18(7-15-9)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,14,16,17) |
InChiKey: | InChIKey=INJVVINKZUVZII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.