* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,2,4]TRIAZOLO[1,5-A]PYRAZIN-8(7H)-ONE, OXIME |
CAS: | 55366-17-1 |
English Synonyms: | [1,2,4]TRIAZOLO[1,5-A]PYRAZIN-8(7H)-ONE, OXIME |
MDL Number.: | MFCD18833210 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cn2c(/c(=N\O)/[nH]1)ncn2 |
InChi: | InChI=1S/C5H5N5O/c11-9-4-5-7-3-8-10(5)2-1-6-4/h1-3,11H,(H,6,9) |
InChiKey: | InChIKey=MNJDBCCYCULRJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.