* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ALLITHIAMINE |
| CAS: | 554-44-9 |
| English Synonyms: | ALLITHIAMINE |
| MDL Number.: | MFCD18910604 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | Cc1ncc(c(n1)N)CN(C=O)/C(=C(/CCO)\SSCC=C)/C |
| InChi: | InChI=1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- |
| InChiKey: | InChIKey=WNCAVNGLACHSRZ-KAMYIIQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.