* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOIBERIN |
| CAS: | 554-88-1 |
| English Synonyms: | GLUCOIBERIN |
| MDL Number.: | MFCD09752807 |
| H bond acceptor: | 11 |
| H bond donor: | 5 |
| Smile: | CS(=O)CCC/C(=N\OS(=O)(=O)O)/S[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| InChi: | InChI=1S/C11H21NO10S3/c1-24(17)4-2-3-7(12-22-25(18,19)20)23-11-10(16)9(15)8(14)6(5-13)21-11/h6,8-11,13-16H,2-5H2,1H3,(H,18,19,20)/b12-7+/t6-,8-,9+,10-,11+,24?/m1/s1 |
| InChiKey: | InChIKey=PHYYADMVYQURSX-WWFIZPDBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.