* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRIDAZINO[1,6-A]INDOLE |
| CAS: | 55402-36-3 |
| English Synonyms: | PYRIDAZINO[1,6-A]INDOLE |
| MDL Number.: | MFCD13178562 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)cc3n2nccc3 |
| InChi: | InChI=1S/C11H8N2/c1-2-6-11-9(4-1)8-10-5-3-7-12-13(10)11/h1-8H |
| InChiKey: | InChIKey=FOBGAMWWMRWTMC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.