* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,6-DIAZABICYCLO[3.2.0]HEPTANE |
CAS: | 55402-83-0 |
English Synonyms: | 3,6-DIAZABICYCLO[3.2.0]HEPTANE |
MDL Number.: | MFCD09991682 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | C1C2CNC2CN1 |
InChi: | InChI=1S/C5H10N2/c1-4-2-7-5(4)3-6-1/h4-7H,1-3H2 |
InChiKey: | InChIKey=XKEYAOJRNJYJMM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.