* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROTAMICILLIN |
CAS: | 55530-41-1 |
English Synonyms: | ROTAMICILLIN |
MDL Number.: | MFCD00868475 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](c3ccccc3)NC(=O)Cc4ccc(cc4)C5=NCCCN5)C(=O)O)C |
InChi: | InChI=1S/C28H31N5O5S/c1-28(2)22(27(37)38)33-25(36)21(26(33)39-28)32-24(35)20(17-7-4-3-5-8-17)31-19(34)15-16-9-11-18(12-10-16)23-29-13-6-14-30-23/h3-5,7-12,20-22,26H,6,13-15H2,1-2H3,(H,29,30)(H,31,34)(H,32,35)(H,37,38)/t20-,21-,22+,26-/m1/s1 |
InChiKey: | InChIKey=PXNNCSKFUDOUJS-ZUVQJFRASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.