* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,6-NAPHTHYRIDIN-8-AMINE |
CAS: | 55570-63-3 |
English Synonyms: | 1,6-NAPHTHYRIDIN-8-AMINE |
MDL Number.: | MFCD18384668 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc2cncc(c2nc1)N |
InChi: | InChI=1S/C8H7N3/c9-7-5-10-4-6-2-1-3-11-8(6)7/h1-5H,9H2 |
InChiKey: | InChIKey=NZAZNWUGAFUFIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.