* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2,5,7,8-PENTAMETHYLCHROMAN |
CAS: | 55646-01-0 |
English Synonyms: | 2,2,5,7,8-PENTAMETHYLCHROMAN |
MDL Number.: | MFCD00192381 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cc1cc(c2c(c1C)OC(CC2)(C)C)C |
InChi: | InChI=1S/C14H20O/c1-9-8-10(2)12-6-7-14(4,5)15-13(12)11(9)3/h8H,6-7H2,1-5H3 |
InChiKey: | InChIKey=XFZYPCNLVHSQTG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.