* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | N(3,5-DIMETHOXYPHENYL)-2-((4-ET-5-(2-FURYL)-4H-1,2,4-TRIAZOL-3-YL)THIO)ACETAMIDE |
| CAS: | 557069-70-2 |
| English Synonyms: | N(3,5-DIMETHOXYPHENYL)-2-((4-ET-5-(2-FURYL)-4H-1,2,4-TRIAZOL-3-YL)THIO)ACETAMIDE |
| MDL Number.: | MFCD03445054 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CCn1c(nnc1SCC(=O)Nc2cc(cc(c2)OC)OC)c3ccco3 |
| InChi: | InChI=1S/C18H20N4O4S/c1-4-22-17(15-6-5-7-26-15)20-21-18(22)27-11-16(23)19-12-8-13(24-2)10-14(9-12)25-3/h5-10H,4,11H2,1-3H3,(H,19,23) |
| InChiKey: | InChIKey=WTBNDUYHHBBUKY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.