* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (S)-4-(1-METHYLPROPYL)-PYRIDINE |
CAS: | 55740-86-8 |
English Synonyms: | (S)-4-(1-METHYLPROPYL)-PYRIDINE |
MDL Number.: | MFCD18384429 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC[C@H](C)c1ccncc1 |
InChi: | InChI=1S/C9H13N/c1-3-8(2)9-4-6-10-7-5-9/h4-8H,3H2,1-2H3/t8-/m0/s1 |
InChiKey: | InChIKey=HGMLMFWWXQNLLV-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.