* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IODOACETIC ACID (2-13C) |
CAS: | 55757-50-1 |
English Synonyms: | IODOACETIC ACID (2-13C) |
MDL Number.: | MFCD00083994 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | [13CH2](C(=O)O)I |
InChi: | InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5)/i1+1 |
InChiKey: | InChIKey=JDNTWHVOXJZDSN-OUBTZVSYSA-N |
Property |
|
Melting Point: | 77-79 DEG C(LIT) |
Comments: | MASS SHIFT: M+1 RIDADR: UN 2923 8/PG 1 WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 186.93 BY ATOM % CALCULATION |
Safety information |
|
Symbol: | GHS05 GHS06 |
Signal word: | Danger |
Hazard statements: | H301-H314 |
Precautionary statements: | P280-P301 + P310-P305 + P351 + P338-P310 |
hazard symbol: | T,C |
Risk Code: | R:25-35 |
Safe Code: | S:22-36/37/39-45 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.