* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[1,5-A]-1,3,5-TRIAZINE-2,4-DIAMINE |
CAS: | 557791-38-5 |
English Synonyms: | IMIDAZO[1,5-A]-1,3,5-TRIAZINE-2,4-DIAMINE |
MDL Number.: | MFCD09263826 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c2nc(nc(n2cn1)N)N |
InChi: | InChI=1S/C5H6N6/c6-4-9-3-1-8-2-11(3)5(7)10-4/h1-2H,(H4,6,7,9,10) |
InChiKey: | InChIKey=NWGYTBFAOAGKPV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.