* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4-DIBROMO-6-PHENYLPHENOL |
CAS: | 55815-20-8 |
English Synonyms: | 2,4-DIBROMO-6-PHENYLPHENOL |
MDL Number.: | MFCD00009714 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)c2cc(cc(c2O)Br)Br |
InChi: | InChI=1S/C12H8Br2O/c13-9-6-10(12(15)11(14)7-9)8-4-2-1-3-5-8/h1-7,15H |
InChiKey: | InChIKey=FLAJYIKIPQZYAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.