* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6,7-DIHYDRO-3,8(2H,5H)-ISOQUINOLINEDIONE |
CAS: | 56053-57-7 |
English Synonyms: | 6,7-DIHYDRO-3,8(2H,5H)-ISOQUINOLINEDIONE |
MDL Number.: | MFCD18431771 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c2c(c[nH]c1=O)C(=O)CCC2 |
InChi: | InChI=1S/C9H9NO2/c11-8-3-1-2-6-4-9(12)10-5-7(6)8/h4-5H,1-3H2,(H,10,12) |
InChiKey: | InChIKey=NGYCSPHUDLPSJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.