* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(1-BUTEN-1-YL)-2-METHYL-PYRIDINE |
CAS: | 56057-98-8 |
English Synonyms: | 5-[(1E)-BUT-1-EN-1-YL]-2-METHYLPYRIDINE ; 5-(1-BUTEN-1-YL)-2-METHYL-PYRIDINE |
MDL Number.: | MFCD18384666 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC/C=C/c1ccc(nc1)C |
InChi: | InChI=1S/C10H13N/c1-3-4-5-10-7-6-9(2)11-8-10/h4-8H,3H2,1-2H3/b5-4+ |
InChiKey: | InChIKey=PYGFQURPESKNNU-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.