* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPIRO[5.5]UNDECANE-3,9-DIONE |
CAS: | 5607-35-2 |
English Synonyms: | SPIRO[5.5]UNDECANE-3,9-DIONE |
MDL Number.: | MFCD17013055 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CC2(CCC1=O)CCC(=O)CC2 |
InChi: | InChI=1S/C11H16O2/c12-9-1-5-11(6-2-9)7-3-10(13)4-8-11/h1-8H2 |
InChiKey: | InChIKey=HGGWRQYOSSKROI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.