* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(3-TOLYLTHIO)-2,4,7-TRIAMINOPTERIDINE |
CAS: | 56107-37-0 |
English Synonyms: | 6-(3-TOLYLTHIO)-2,4,7-TRIAMINOPTERIDINE |
MDL Number.: | MFCD00054574 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | Cc1cccc(c1)Sc2c(nc3c(n2)c(nc(n3)N)N)N |
InChi: | InChI=1S/C13H13N7S/c1-6-3-2-4-7(5-6)21-12-10(15)18-11-8(17-12)9(14)19-13(16)20-11/h2-5H,1H3,(H6,14,15,16,18,19,20) |
InChiKey: | InChIKey=XICJMEJRTKALQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.