* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ASPERGLAUCIDE |
CAS: | 56121-42-7 |
English Synonyms: | ASPERGLAUCIDE |
MDL Number.: | MFCD17214814 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(=O)OC[C@H](Cc1ccccc1)NC(=O)[C@H](Cc2ccccc2)NC(=O)c3ccccc3 |
InChi: | InChI=1S/C27H28N2O4/c1-20(30)33-19-24(17-21-11-5-2-6-12-21)28-27(32)25(18-22-13-7-3-8-14-22)29-26(31)23-15-9-4-10-16-23/h2-16,24-25H,17-19H2,1H3,(H,28,32)(H,29,31)/t24-,25-/m0/s1 |
InChiKey: | InChIKey=VZPAURMDJZOGHU-DQEYMECFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.