* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-ANTHRA[1,9-CD]PYRAZOL-6(2H)-ONE |
CAS: | 56150-01-7 |
English Synonyms: | 7-CHLORO-ANTHRA[1,9-CD]PYRAZOL-6(2H)-ONE |
MDL Number.: | MFCD00179005 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cc-2c(c(c1)Cl)C(=O)c3cccc4c3c2n[nH]4 |
InChi: | InChI=1S/C14H7ClN2O/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10-12(8)13(7)17-16-10/h1-6H,(H,16,17) |
InChiKey: | InChIKey=BYQXKBNIRSADGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.