* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XIMOPROFEN |
| CAS: | 56187-89-4 |
| English Synonyms: | XIMOPROFEN |
| MDL Number.: | MFCD00866117 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(c1ccc(cc1)C2CCC/C(=N/O)/C2)C(=O)O |
| InChi: | InChI=1S/C15H19NO3/c1-10(15(17)18)11-5-7-12(8-6-11)13-3-2-4-14(9-13)16-19/h5-8,10,13,19H,2-4,9H2,1H3,(H,17,18)/b16-14- |
| InChiKey: | InChIKey=IQPPOXSMSDPZKU-PEZBUJJGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.