* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4,7-DIMETHYLINDOLE |
| CAS: | 5621-17-0 |
| English Synonyms: | 4,7-DIMETHYL-1H-INDOLE ; ABLOCK AB-12-2514 ; 4,7-DIMETHYLINDOLE |
| MDL Number.: | MFCD00049348 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c2c1cc[nH]2)C |
| InChi: | InChI=1S/C10H11N/c1-7-3-4-8(2)10-9(7)5-6-11-10/h3-6,11H,1-2H3 |
| InChiKey: | InChIKey=CWEVPNVDMCDPMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.