* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-N-FMOC-3-BROMOPIPERID-4-ONE |
CAS: | 562827-16-1 |
English Synonyms: | 1-N-FMOC-3-BROMOPIPERID-4-ONE |
MDL Number.: | MFCD09953305 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N4CCC(=O)C(C4)Br |
InChi: | InChI=1S/C20H18BrNO3/c21-18-11-22(10-9-19(18)23)20(24)25-12-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,17-18H,9-12H2 |
InChiKey: | InChIKey=AOMYTMXBSGKEDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.