* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UNCARINE C |
CAS: | 5629-60-7 |
English Synonyms: | PTEROPODINE ; UNCARINE C |
MDL Number.: | MFCD03788764 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C[C@H]1[C@@H]2CN3CC[C@]4([C@@H]3C[C@@H]2C(=CO1)C(=O)OC)c5ccccc5NC4=O |
InChi: | InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14-,18-,21+/m0/s1 |
InChiKey: | InChIKey=JMIAZDVHNCCPDM-QLMFUGSGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.