* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-METHOXY-ETHANOL |
| CAS: | 563-64-4 |
| English Synonyms: | ETHANOL, 1-METHOXY- ; 1-METHOXY-ETHANOL |
| MDL Number.: | MFCD22053365 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(O)OC |
| InChi: | InChI=1S/C3H8O2/c1-3(4)5-2/h3-4H,1-2H3 |
| InChiKey: | InChIKey=GEGLCBTXYBXOJA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.