* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,2-DICHLORONONANE |
| CAS: | 56375-96-3 |
| English Synonyms: | 1,2-DICHLORONONANE |
| MDL Number.: | MFCD04972197 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CCCCCCCC(CCl)Cl |
| InChi: | InChI=1S/C9H18Cl2/c1-2-3-4-5-6-7-9(11)8-10/h9H,2-8H2,1H3 |
| InChiKey: | InChIKey=SAWALGNBNOPQEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.