* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (2S)-2-AMINO-1-(PYRROLIDIN-1-YL)PROPAN-1-ONE |
CAS: | 56384-04-4 |
English Synonyms: | 1-PROPANONE, 2-AMINO-1-(1-PYRROLIDINYL)-, (2S)- ; (2S)-2-AMINO-1-(PYRROLIDIN-1-YL)PROPAN-1-ONE |
MDL Number.: | MFCD09724339 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C[C@@H](C(=O)N1CCCC1)N |
InChi: | InChI=1S/C7H14N2O/c1-6(8)7(10)9-4-2-3-5-9/h6H,2-5,8H2,1H3/t6-/m0/s1 |
InChiKey: | InChIKey=IVBVTDXOGUNDHC-LURJTMIESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.