* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,3,4,5-TETRABROMO-1-METHYL-1H-PYRROLE |
CAS: | 56454-29-6 |
English Synonyms: | 2,3,4,5-TETRABROMO-1-METHYL-1H-PYRROLE |
MDL Number.: | MFCD18377861 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | Cn1c(c(c(c1Br)Br)Br)Br |
InChi: | InChI=1S/C5H3Br4N/c1-10-4(8)2(6)3(7)5(10)9/h1H3 |
InChiKey: | InChIKey=JVMUDXOIJHPXMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.