* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JYL-1433 |
| CAS: | 565448-40-0 |
| English Synonyms: | JYL-1433 |
| MDL Number.: | MFCD08702718 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(cc1C)CC(CNC(=S)NCc2ccc(c(c2)F)NS(=O)(=O)C)COC(=O)C(C)(C)C |
| InChi: | InChI=1S/C26H36FN3O4S2/c1-17-7-8-19(11-18(17)2)12-21(16-34-24(31)26(3,4)5)15-29-25(35)28-14-20-9-10-23(22(27)13-20)30-36(6,32)33/h7-11,13,21,30H,12,14-16H2,1-6H3,(H2,28,29,35) |
| InChiKey: | InChIKey=MBFLALIYFBMPJK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.