* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CYCLO(-HIS-PHE) |
CAS: | 56586-95-9 |
English Synonyms: | CYCLO(-HIS-PHE) |
MDL Number.: | MFCD00135317 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)C[C@H]2C(=O)N[C@H](C(=O)N2)Cc3c[nH]cn3 |
InChi: | InChI=1S/C15H16N4O2/c20-14-12(6-10-4-2-1-3-5-10)18-15(21)13(19-14)7-11-8-16-9-17-11/h1-5,8-9,12-13H,6-7H2,(H,16,17)(H,18,21)(H,19,20)/t12-,13-/m0/s1 |
InChiKey: | InChIKey=HLXXMJDWTBXTOR-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.