* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPIROMUSTINE |
| CAS: | 56605-16-4 |
| English Synonyms: | PROSPIDIUM ; SPIROMUSTINE |
| MDL Number.: | MFCD00866539 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C1CCC2(CC1)C(=O)N(C(=O)N2)CCN(CCCl)CCCl |
| InChi: | InChI=1S/C14H23Cl2N3O2/c15-6-8-18(9-7-16)10-11-19-12(20)14(17-13(19)21)4-2-1-3-5-14/h1-11H2,(H,17,21) |
| InChiKey: | InChIKey=QNKJFXARIMSDBR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.