* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-OH-BTA-1 |
CAS: | 566169-93-5 |
English Synonyms: | 6-OH-BTA-1 ; 2-[4-(METHYLAMINO)-PHENYL]-6-BENZOTHIAZOLOL |
MDL Number.: | MFCD17018727 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CNc1ccc(cc1)c2nc3ccc(cc3s2)O |
InChi: | InChI=1S/C14H12N2OS/c1-15-10-4-2-9(3-5-10)14-16-12-7-6-11(17)8-13(12)18-14/h2-8,15,17H,1H3 |
InChiKey: | InChIKey=ZQAQXZBSGZUUNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.