* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,5'-((2-hydroxypropane-1,3-diyl)bis(oxy))bis(3,4-dihydroquinolin-2(1H)-one) |
CAS: | 56660-90-3 |
English Synonyms: | 5,5'-((2-HYDROXYPROPANE-1,3-DIYL)BIS(OXY))BIS(3,4-DIHYDROQUINOLIN-2(1H)-ONE) |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OC(COC1=C2CCC(NC2=CC=C1)=O)COC1=C2CCC(NC2=CC=C1)=O |
InChi: | InChI=1S/C21H22N2O5/c24-13(11-27-18-5-1-3-16-14(18)7-9-20(25)22-16)12-28-19-6-2-4-17-15(19)8-10-21(26)23-17/h1-6,13,24H,7-12H2,(H,22,25)(H,23,26) |
InChiKey: | InChIKey=OXFQNSYUOMGLAL-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.