* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROSAPROSTOL |
CAS: | 56695-65-9 |
English Synonyms: | ROSAPROSTOL |
MDL Number.: | MFCD00868206 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CCCCCC[C@H]1CCC([C@@H]1CCCCCCC(=O)O)O |
InChi: | InChI=1S/C18H34O3/c1-2-3-4-7-10-15-13-14-17(19)16(15)11-8-5-6-9-12-18(20)21/h15-17,19H,2-14H2,1H3,(H,20,21)/t15-,16+,17?/m0/s1 |
InChiKey: | InChIKey=NMAOJFAMEOVURT-RTKIROINSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.