* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-METHYL-1,4-HEPTADIENE |
CAS: | 5678-99-9 |
English Synonyms: | 5-METHYL-1,4-HEPTADIENE ; (4E)-5-METHYLHEPTA-1,4-DIENE |
MDL Number.: | MFCD00060943 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC/C(=C/CC=C)/C |
InChi: | InChI=1S/C8H14/c1-4-6-7-8(3)5-2/h4,7H,1,5-6H2,2-3H3/b8-7+ |
InChiKey: | InChIKey=DOGRYWZHOBYUMD-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.