* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1H,2H,4H-PYRIDO[4,3-D][1,3]OXAZINE-2,4-DIONE |
CAS: | 56788-14-8 |
English Synonyms: | 2H-PYRIDO[4,3-D][1,3]OXAZINE-2,4(1H)-DIONE ; 1H,2H,4H-PYRIDO[4,3-D][1,3]OXAZINE-2,4-DIONE |
MDL Number.: | MFCD18836852 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cncc2c1[nH]c(=O)oc2=O |
InChi: | InChI=1S/C7H4N2O3/c10-6-4-3-8-2-1-5(4)9-7(11)12-6/h1-3H,(H,9,11) |
InChiKey: | InChIKey=UNXFCQGFUJLIOR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.