* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CHLOROTHIENO[2,3-D]PYRIMIDIN-4-AMINE |
| CAS: | 56844-22-5 |
| English Synonyms: | 2-CHLOROTHIENO[2,3-D]PYRIMIDIN-4-AMINE |
| MDL Number.: | MFCD14554907 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1csc2c1c(nc(n2)Cl)N |
| InChi: | InChI=1S/C6H4ClN3S/c7-6-9-4(8)3-1-2-11-5(3)10-6/h1-2H,(H2,8,9,10) |
| InChiKey: | InChIKey=GOBLWWCPIDMWPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.