* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,5-DIMETHYLBENZAMIDE |
| CAS: | 5692-35-3 |
| English Synonyms: | 3,5-DIMETHYLBENZAMIDE ; BENZAMIDE, 3,5-DIMETHYL- |
| MDL Number.: | MFCD11643198 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cc(cc(c1)C(=O)N)C |
| InChi: | InChI=1S/C9H11NO/c1-6-3-7(2)5-8(4-6)9(10)11/h3-5H,1-2H3,(H2,10,11) |
| InChiKey: | InChIKey=ZGPFNDFPSMUWJJ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.