* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-PENTEN-3-ONE, 5-(1,3-DIOXOLAN-2-YL)- |
CAS: | 57072-56-7 |
English Synonyms: | 5-(1,3-DIOXOLAN-2-YL)PENT-1-EN-3-ONE ; 5-(1,3-DIOXOLAN-2-YL)-1-PENTEN-3-ONE ; 1-PENTEN-3-ONE, 5-(1,3-DIOXOLAN-2-YL)- |
MDL Number.: | MFCD18810810 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C=CC(=O)CCC1OCCO1 |
InChi: | InChI=1S/C8H12O3/c1-2-7(9)3-4-8-10-5-6-11-8/h2,8H,1,3-6H2 |
InChiKey: | InChIKey=OHZADBDKGCRTGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.