* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-PHE-PHE-OH |
CAS: | 57092-52-1 |
English Synonyms: | Z-PHE-PHE-PHE-OH |
MDL Number.: | MFCD00238499 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)N[C@@H](Cc2ccccc2)C(=O)O)NC(=O)[C@H](Cc3ccccc3)NC(=O)OCc4ccccc4 |
InChi: | InChI=1S/C35H35N3O6/c39-32(37-31(34(41)42)23-27-17-9-3-10-18-27)29(21-25-13-5-1-6-14-25)36-33(40)30(22-26-15-7-2-8-16-26)38-35(43)44-24-28-19-11-4-12-20-28/h1-20,29-31H,21-24H2,(H,36,40)(H,37,39)(H,38,43)(H,41,42)/t29-,30-,31-/m0/s1 |
InChiKey: | InChIKey=BQDHGVWUXAXFMT-CHQNGUEUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.