* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 7-(1,1-DIMETHYLETHYL)-SPIRO[3.5]NONANE-1,3-DIONE |
CAS: | 571152-35-7 |
English Synonyms: | 7-(1,1-DIMETHYLETHYL)-SPIRO[3.5]NONANE-1,3-DIONE ; SPIRO[3.5]NONANE-1,3-DIONE, 7-(1,1-DIMETHYLETHYL)- |
MDL Number.: | MFCD18642688 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(C)(C)C1CCC2(CC1)C(=O)CC2=O |
InChi: | InChI=1S/C13H20O2/c1-12(2,3)9-4-6-13(7-5-9)10(14)8-11(13)15/h9H,4-8H2,1-3H3 |
InChiKey: | InChIKey=OGSPSUDMMYJEPD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.