Molecular Structure:
CAS No.:
571201-15-5
Product Name.:
CCD No.:CCD04479613
Formula:C6 H7 N O2
MolWeight:125.126
![1H,3H-PYRROLO[1,2-C]OXAZOL-3-ONE, 5,7A-DIHYDRO-, (7AS)- Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1H,3H-PYRROLO[1,2-C]OXAZOL-3-ONE, 5,7A-DIHYDRO-, (7AS)- |
| CAS： | 571201-15-5 |
| English Synonyms： | 1H,3H-PYRROLO[1,2-C]OXAZOL-3-ONE, 5,7A-DIHYDRO-, (7AS)- |
| MDL Number.： | MFCD18829912 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | C1C=C[C@@H]2N1C(=O)OC2 |
| InChi： | InChI=1S/C6H7NO2/c8-6-7-3-1-2-5(7)4-9-6/h1-2,5H,3-4H2/t5-/m0/s1 |
| InChiKey： | InChIKey=BOEKBAFJZFGCRD-YFKPBYRVSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
