* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-METHOXYHEXAN-2-ONE |
| CAS: | 57134-36-8 |
| English Synonyms: | 1-METHOXYHEXAN-2-ONE |
| MDL Number.: | MFCD16807848 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCC(=O)COC |
| InChi: | InChI=1S/C7H14O2/c1-3-4-5-7(8)6-9-2/h3-6H2,1-2H3 |
| InChiKey: | InChIKey=HPVRZSQOEHEUKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.