* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SPIRO[BICYCLO[2.2.2]OCTANE-2,2'-OXIRANE] |
| CAS: | 57289-81-3 |
| English Synonyms: | SPIRO[BICYCLO[2.2.2]OCTANE-2,2'-OXIRANE] |
| MDL Number.: | MFCD17012830 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C1C[C@H]2CC[C@@H]1CC23CO3 |
| InChi: | InChI=1S/C9H14O/c1-3-8-4-2-7(1)5-9(8)6-10-9/h7-8H,1-6H2/t7-,8+,9? |
| InChiKey: | InChIKey=ONNAEQZTVHAHMV-JVHMLUBASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.