* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODO-PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
| CAS: | 572911-00-3 |
| English Synonyms: | 8-IODO-PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
| MDL Number.: | MFCD18073971 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1c(c2ncncn2n1)I |
| InChi: | InChI=1S/C5H3IN4/c6-4-1-9-10-3-7-2-8-5(4)10/h1-3H |
| InChiKey: | InChIKey=VLQAIOPQSMGGJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.