* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-OXO-4,8-DIHYDRO-[1,2,4]TRIAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID |
CAS: | 57351-60-7 |
English Synonyms: | 4-OXO-4,8-DIHYDRO-[1,2,4]TRIAZOLO[5,1-C][1,2,4]TRIAZINE-3-CARBOXYLIC ACID |
MDL Number.: | MFCD17779305 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1[nH]c2nnc(c(=O)n2n1)C(=O)O |
InChi: | InChI=1S/C5H3N5O3/c11-3-2(4(12)13)8-9-5-6-1-7-10(3)5/h1H,(H,12,13)(H,6,7,9) |
InChiKey: | InChIKey=JIBDAVOXBCHZPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.