* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ETHYL-4-ETHYNYL-1H-PYRAZOLE |
CAS: | 573982-81-7 |
English Synonyms: | 1-ETHYL-4-ETHYNYL-1H-PYRAZOLE |
MDL Number.: | MFCD17281919 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCn1cc(cn1)C#C |
InChi: | InChI=1S/C7H8N2/c1-3-7-5-8-9(4-2)6-7/h1,5-6H,4H2,2H3 |
InChiKey: | InChIKey=GRNLVMIFGKUZFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.